پرش به محتوا

وانیلین

ویکیپدیادان، آچیق بیلیکلیکدن

{{Chembox| Verifiedfields = changed| Watchedfields = changed| verifiedrevid = 456486843| ImageFileL1 = Vanillin2.svg| ImageFileL1_Ref = | ImageNameL1 = Skeletal formula of a vanillin minor tautomer| ImageFileR1 = Vanillin-3d.png| ImageFileR1_Ref = | ImageNameR1 = Spacefill model of a vanillin minor tautomer| PIN = 4-Hydroxy-3-methoxybenzaldehyde| OtherNames = Vanillin[۱]
Methyl vanillin[۱]
Vanillic aldehyde[۲]|Section1=! style= "background: #F8EABA; text-align: center;" colspan= "2" | تانیملاییجیلار |-

|سیایاس ثبت نومرهسی |121-33-5YesY |- |پابکم |1183 |- |کماسپایدر |13860434YesY |- |UNII |CHI530446XYesY |- |ئیسی نومرهسی |204-465-2 |-



|MeSH |{{{MeSHName}}} |-

|ChEMBL | {{#if:13883|CHEMBL13883YesY |-

|RTECS number | YW5775000 |-

|

| 472792 |-

|

| 3596 |- | 3DMet |{{{3DMet}}} |- |جیمول-تصاویر سه بعدی | {{#if:c1(C=O)cc(OC)c(O)cc1|Image 1 |-

| align= "center" colspan= "2" |

  • c1(C=O)cc(OC)c(O)cc1

|-

| align= "center" colspan= "2" |

  • InChI=1S/C8H8O3/c1-11-8-4-6(5-9)2-3-7(8)10/h2-5,8H,1H3N
    Key: MWOOGOJBHIARFG-UHFFFAOYSA-NN


    InChI=1/C8H8O3/c1-11-8-4-6(5-9)2-3-7(8)10/h2-5,10H,1H3
    Key: MWOOGOJBHIARFG-UHFFFAOYAS

|-|Section2=! colspan=2 style= "background: #f8eaba; text-align: center;" |خوصوصیّتلر

|-

|

|C8H8O3

|- |Molar mass

| ۱۵۲٫۱۵ g·mol−1

|- | Appearance | White crystals |- |Odor | Vanilla, Sweet, Balsamic, Pleasant |- |Density | 1.056 g cm−3 |- |Melting point | ۸۱ تا ۸۳ °C; ۱۷۸ تا ۱۸۱ °F; ۳۵۴ تا ۳۵۶ K

|- |Boiling point | ۲۸۵ °C (۵۴۵ °F; ۵۵۸ K)

|-


|

| 10 g dm−3 |-





|log P | 1.208 |- |Vapor pressure | >1 Pa |-


|Acidity(pKa) | 7.781 |- |Basicity(pKb) | 6.216 |-|Section3=! colspan=2 style= "background: #f8eaba; text-align: center;" |Structure

|- |ساختار بلوری | Monoclinic |-|Section4=! colspan=2 style= "background: #f8eaba; text-align: center;" |Thermochemistry

|-



|

| −3.828 MJ mol−1 |-|Section5={{Chembox Hazards| ExternalSDS =hazard.com| GHSPictograms =The exclamation-mark pictogram in the Globally Harmonized System of Classification and Labelling of Chemicals (GHS)| GHSSignalWord = وانیلین(اینگیلیسجه:Vanillin،روسجا:Ванилин،عربجه:فانيلين) بیر شیمیایی ماده.آغ، کریستال حالتینده تاپیلار.فنولکیمی تانینیر.

بیرده باخ

[دَییشدیر]

قایناقلار

[دَییشدیر]

اینگیلیسجه ویکیپدیاسینین ایشلدنلری طرفیندن یارانمیش«Vanillin»، مقالهسیندن گؤتورولوبدور.( ۲۹ نوْوامبر ۲۰۱۷ تاریخینده یوْخلانیلیبدیر).

قارداش پروژهلردهوانیلینگؤره داها آرتیق بیلگیلر تاپابیلرسینیز.


Search Commonsفایللارویکیآمباردا