وانیلین
{{Chembox| Verifiedfields = changed| Watchedfields = changed| verifiedrevid = 456486843| ImageFileL1 = Vanillin2.svg| ImageFileL1_Ref = | ImageNameL1 = Skeletal formula of a vanillin minor tautomer| ImageFileR1 = Vanillin-3d.png| ImageFileR1_Ref = | ImageNameR1 = Spacefill model of a vanillin minor tautomer| PIN = 4-Hydroxy-3-methoxybenzaldehyde| OtherNames = Vanillin[۱]
Methyl vanillin[۱]
Vanillic aldehyde[۲]|Section1=! style= "background: #F8EABA; text-align: center;" colspan= "2" | تانیملاییجیلار
|-
|سیایاس ثبت نومرهسی |121-33-5 |- |پابکم |1183 |- |کماسپایدر |13860434 |- |UNII |CHI530446X |- |ئیسی نومرهسی |204-465-2 |-
|MeSH |{{{MeSHName}}} |-
|ChEMBL | {{#if:13883|CHEMBL13883 |-
|RTECS number | YW5775000 |-
|
| 472792 |-
|
| 3596 |- | 3DMet |{{{3DMet}}} |- |جیمول-تصاویر سه بعدی | {{#if:c1(C=O)cc(OC)c(O)cc1|Image 1 |-
| align= "center" colspan= "2" |
c1(C=O)cc(OC)c(O)cc1
|-
| align= "center" colspan= "2" |
InChI=1S/C8H8O3/c1-11-8-4-6(5-9)2-3-7(8)10/h2-5,8H,1H3
Key: MWOOGOJBHIARFG-UHFFFAOYSA-NInChI=1/C8H8O3/c1-11-8-4-6(5-9)2-3-7(8)10/h2-5,10H,1H3
Key: MWOOGOJBHIARFG-UHFFFAOYAS
|-|Section2=! colspan=2 style= "background: #f8eaba; text-align: center;" |خوصوصیّتلر
|-
|
|C8H8O3
|- |Molar mass
| ۱۵۲٫۱۵ g·mol−1
|- | Appearance | White crystals |- |Odor | Vanilla, Sweet, Balsamic, Pleasant |- |Density | 1.056 g cm−3 |- |Melting point | ۸۱ تا ۸۳ °C; ۱۷۸ تا ۱۸۱ °F; ۳۵۴ تا ۳۵۶ K
|- |Boiling point | ۲۸۵ °C (۵۴۵ °F; ۵۵۸ K)
|-
|
| 10 g dm−3 |-
|log P | 1.208 |- |Vapor pressure | >1 Pa |-
|Acidity(pKa)
| 7.781
|-
|Basicity(pKb)
| 6.216
|-|Section3=! colspan=2 style= "background: #f8eaba; text-align: center;" |Structure
|- |ساختار بلوری | Monoclinic |-|Section4=! colspan=2 style= "background: #f8eaba; text-align: center;" |Thermochemistry
|-
|
combustion(ΔcH
| −3.828 MJ mol−1 |-|Section5={{Chembox Hazards| ExternalSDS =hazard.com| GHSPictograms =| GHSSignalWord = وانیلین(اینگیلیسجه:Vanillin،روسجا:Ванилин،عربجه:فانيلين) بیر شیمیایی ماده.آغ، کریستال حالتینده تاپیلار.فنولکیمی تانینیر.
بیرده باخ
[دَییشدیر]قایناقلار
[دَییشدیر]اینگیلیسجه ویکیپدیاسینین ایشلدنلری طرفیندن یارانمیش«Vanillin»، مقالهسیندن گؤتورولوبدور.( ۲۹ نوْوامبر ۲۰۱۷ تاریخینده یوْخلانیلیبدیر).